EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O13 |
| Net Charge | 0 |
| Average Mass | 582.599 |
| Monoisotopic Mass | 582.23124 |
| SMILES | [H][C@]1([C@](O)(CC(=O)O[C@@H](C(=O)O)[C@H](CC(=O)O)C(=O)O)C(=O)O)C[C@H](/C=C/CC/C=C\C/C=C\CCCCC)OC1=O |
| InChI | InChI=1S/C28H38O13/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-15-20(26(36)40-18)28(39,27(37)38)17-22(31)41-23(25(34)35)19(24(32)33)16-21(29)30/h6-7,9-10,13-14,18-20,23,39H,2-5,8,11-12,15-17H2,1H3,(H,29,30)(H,32,33)(H,34,35)(H,37,38)/b7-6-,10-9-,14-13+/t18-,19-,20-,23+,28+/m0/s1 |
| InChIKey | BUDVJTLKHWKZFS-PCIDIATHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fungi | - | PubMed (14748587) | Sterile mycelium Strain: MF6339 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein geranylgeranyltransferase type I (EC 2.5.1.59). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citrafungin B (CHEBI:65636) has functional parent pentaric acid (CHEBI:25896) |
| citrafungin B (CHEBI:65636) has role antifungal agent (CHEBI:35718) |
| citrafungin B (CHEBI:65636) has role EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor (CHEBI:67267) |
| citrafungin B (CHEBI:65636) has role metabolite (CHEBI:25212) |
| citrafungin B (CHEBI:65636) is a butan-4-olide (CHEBI:22950) |
| citrafungin B (CHEBI:65636) is a carboxylic ester (CHEBI:33308) |
| citrafungin B (CHEBI:65636) is a tetracarboxylic acid (CHEBI:35742) |
| IUPAC Name |
|---|
| 3-carboxy-2-O-[(3R)-3-carboxy-3-hydroxy-3-{(3R,5R)-2-oxo-5-[(1E,5Z,8Z)-tetradeca-1,5,8-trien-1-yl]tetrahydrofuran-3-yl}propanoyl]-3,4-dideoxy-L-threo-pentaric acid |
| Manual Xrefs | Databases |
|---|---|
| 9961258 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9681585 | Reaxys |
| Citations |
|---|