EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H66O14 |
| Net Charge | 0 |
| Average Mass | 782.965 |
| Monoisotopic Mass | 782.44526 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](O)CO[C@@]2([H])O[C@H]2CC[C@]34C[C@]35CC[C@]3(C)[C@@]6([H])[C@H](C)C[C@@]7([H])O[C@@]6(O[C@@H]7C(C)(C)O)[C@H](O)[C@@]3(C)[C@]5([H])CC[C@@]4([H])C2(C)C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C41H66O14/c1-18-14-20-31(36(4,5)49)55-41(54-20)30(18)37(6)12-13-40-17-39(40)11-10-24(35(2,3)22(39)8-9-23(40)38(37,7)34(41)48)52-33-29(25(44)19(43)16-50-33)53-32-28(47)27(46)26(45)21(15-42)51-32/h18-34,42-49H,8-17H2,1-7H3/t18-,19-,20-,21-,22+,23+,24+,25+,26-,27+,28-,29-,30-,31+,32+,33+,34-,37-,38-,39-,40+,41+/m1/s1 |
| InChIKey | MWAASJAPNVCCKT-JHNAHLGXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cimicifuga foetida (ncbitaxon:64032) | aerial part (BTO:0001658) | PubMed (19280146) |
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cimifoetiside B (CHEBI:65633) has functional parent cimigenol (CHEBI:37777) |
| cimifoetiside B (CHEBI:65633) has parent hydride cycloartane (CHEBI:37778) |
| cimifoetiside B (CHEBI:65633) has role immunosuppressive agent (CHEBI:35705) |
| cimifoetiside B (CHEBI:65633) has role plant metabolite (CHEBI:76924) |
| cimifoetiside B (CHEBI:65633) is a bridged compound (CHEBI:35990) |
| cimifoetiside B (CHEBI:65633) is a diol (CHEBI:23824) |
| cimifoetiside B (CHEBI:65633) is a disaccharide derivative (CHEBI:63353) |
| cimifoetiside B (CHEBI:65633) is a oxacycle (CHEBI:38104) |
| cimifoetiside B (CHEBI:65633) is a secondary alcohol (CHEBI:35681) |
| cimifoetiside B (CHEBI:65633) is a tertiary alcohol (CHEBI:26878) |
| cimifoetiside B (CHEBI:65633) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (2S,4aR,5aS,7aR,7bR,8R,10R,11S,12aS,13R,13aS,13bR,15aR)-13-hydroxy-11-(2-hydroxypropan-2-yl)-1,1,7a,8,13a-pentamethyloctadecahydro-10,12a-epoxycyclopropa[1',8a']naphtho[2',1':4,5]indeno[2,1-b]oxepin-2-yl 2-O-β-D-glucopyranosyl-β-D-xylopyranoside |
| Synonym | Source |
|---|---|
| (23R,24S) cimicigenol 3-O-β-D-glucopyranosyl-(1→2)-β-D-xylopyranoside | ChEBI |