EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37N3O3 |
| Net Charge | 0 |
| Average Mass | 415.578 |
| Monoisotopic Mass | 415.28349 |
| SMILES | CCCCCCCC(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@@H]1CCCCNC1=O |
| InChI | InChI=1S/C24H37N3O3/c1-3-4-5-6-10-16-22(28)27(2)21(18-19-13-8-7-9-14-19)24(30)26-20-15-11-12-17-25-23(20)29/h7-9,13-14,20-21H,3-6,10-12,15-18H2,1-2H3,(H,25,29)(H,26,30)/t20-,21-/m1/s1 |
| InChIKey | FNPKNWJUFWGJJV-NHCUHLMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aaptos ciliata (WORMS:170732) | - | PubMed (18257536) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciliatamide B (CHEBI:65631) has functional parent octanoic acid (CHEBI:28837) |
| ciliatamide B (CHEBI:65631) has role antileishmanial agent (CHEBI:70868) |
| ciliatamide B (CHEBI:65631) has role antineoplastic agent (CHEBI:35610) |
| ciliatamide B (CHEBI:65631) has role metabolite (CHEBI:25212) |
| ciliatamide B (CHEBI:65631) is a caprolactams (CHEBI:23000) |
| ciliatamide B (CHEBI:65631) is a lipopeptide (CHEBI:46895) |
| IUPAC Name |
|---|
| Nα-methyl-Nα-octanoyl-N-[(3R)-2-oxoazepan-3-yl]-D-phenylalaninamide |
| Synonyms | Source |
|---|---|
| N-methyl-N-[(2R)-1-oxo-1-[[(3R)-2-oxoazepan-3-yl]amino]-3-phenylpropan-2-yl]octanamide | ChEBI |
| (R,R)-ciliatamide B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19040123 | Reaxys |
| Citations |
|---|