EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26O10 |
| Net Charge | 0 |
| Average Mass | 570.550 |
| Monoisotopic Mass | 570.15260 |
| SMILES | [H][C@@]1([C@]2([H])C(=O)c3c(O)cc(OC)cc3O[C@]2([H])c2ccc(OC)cc2)C(=O)c2c(O)cc(O)cc2O[C@]1([H])c1ccc(O)cc1 |
| InChI | InChI=1S/C32H26O10/c1-39-19-9-5-16(6-10-19)32-28(30(38)26-22(36)13-20(40-2)14-24(26)42-32)27-29(37)25-21(35)11-18(34)12-23(25)41-31(27)15-3-7-17(33)8-4-15/h3-14,27-28,31-36H,1-2H3/t27-,28-,31-,32-/m1/s1 |
| InChIKey | BFPJOJFVZXWMSM-QWWQXMGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stellera chamaejasme (ncbitaxon:142738) | root (BTO:0001188) | PubMed (15997133) |
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chamaejasmenin D (CHEBI:65615) has role antifungal agent (CHEBI:35718) |
| chamaejasmenin D (CHEBI:65615) has role antimitotic (CHEBI:64911) |
| chamaejasmenin D (CHEBI:65615) has role plant metabolite (CHEBI:76924) |
| chamaejasmenin D (CHEBI:65615) is a 4'-methoxyflavanones (CHEBI:140332) |
| chamaejasmenin D (CHEBI:65615) is a biflavonoid (CHEBI:50128) |
| chamaejasmenin D (CHEBI:65615) is a hydroxyflavanone (CHEBI:24697) |
| chamaejasmenin D (CHEBI:65615) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2S*,2'S*,3S*,3'S*)-5,5',7-trihydroxy-2-(4-hydroxyphenyl)-7'-methoxy-2'-(4-methoxyphenyl)-2,2',3,3'-tetrahydro-4H,4'H-3,3'-bichromene-4,4'-dione |
| Synonym | Source |
|---|---|
| (+)-(3,3'-bi-4H-1-benzopyran)-4,4'-dione,2,2',3,3'-tetrahydro-5,5',7'-trihydroxy-7-methoxy-2-(4-methoxyphenyl)-2'-(4-hydroxyphenyl) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10140631 | Reaxys |
| Citations |
|---|