EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O6 |
| Net Charge | 0 |
| Average Mass | 354.358 |
| Monoisotopic Mass | 354.11034 |
| SMILES | COc1cccc2oc3cc4c(c(O)c3c(=O)c12)C1CCCC(C)(O4)O1 |
| InChI | InChI=1S/C20H18O6/c1-20-8-4-7-12(25-20)16-14(26-20)9-13-17(19(16)22)18(21)15-10(23-2)5-3-6-11(15)24-13/h3,5-6,9,12,22H,4,7-8H2,1-2H3 |
| InChIKey | ZUEKQPJBVORAFH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium (ncbitaxon:5149) | - | PubMed (18683985) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoxanthone B (CHEBI:65612) has role antiprotozoal drug (CHEBI:35820) |
| chaetoxanthone B (CHEBI:65612) has role metabolite (CHEBI:25212) |
| chaetoxanthone B (CHEBI:65612) is a bridged compound (CHEBI:35990) |
| chaetoxanthone B (CHEBI:65612) is a cyclic ketal (CHEBI:59779) |
| chaetoxanthone B (CHEBI:65612) is a cyclic ketone (CHEBI:3992) |
| chaetoxanthone B (CHEBI:65612) is a organic heteropentacyclic compound (CHEBI:38164) |
| chaetoxanthone B (CHEBI:65612) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 7-hydroxy-9-methoxy-2-methyl-3,4,5,6-tetrahydro-2H,8H-2,6-epoxyoxocino[3,2-b]xanthen-8-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19305736 | Reaxys |
| Citations |
|---|