EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18N4O4 |
| Net Charge | 0 |
| Average Mass | 402.410 |
| Monoisotopic Mass | 402.13281 |
| SMILES | [H][C@@]12N3C(=O)[C@H](C)N1C(=O)[C@H](n1cnc4ccccc4c1=O)C[C@]2(O)c1ccccc13 |
| InChI | InChI=1S/C22H18N4O4/c1-12-18(27)26-16-9-5-3-7-14(16)22(30)10-17(20(29)25(12)21(22)26)24-11-23-15-8-4-2-6-13(15)19(24)28/h2-9,11-12,17,21,30H,10H2,1H3/t12-,17+,21-,22-/m0/s1 |
| InChIKey | GEURDGODABUDHB-TYTLQBBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium (ncbitaxon:5149) | - | PubMed (17134253) | Endophytic fungus on the leaves of Adenophora axilliflora Strain: IFB-E015 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetominine (CHEBI:65610) has role metabolite (CHEBI:25212) |
| chaetominine (CHEBI:65610) is a indole alkaloid (CHEBI:38958) |
| chaetominine (CHEBI:65610) is a lactam (CHEBI:24995) |
| chaetominine (CHEBI:65610) is a organic heterotetracyclic compound (CHEBI:38163) |
| chaetominine (CHEBI:65610) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| (2S,4R,5aS,9cS)-5a-hydroxy-2-methyl-4-(4-oxoquinazolin-3(4H)-yl)-4,5,5a,9c-tetrahydro-3H-2a,9b-diazacyclopenta[jk]fluorene-1,3(2H)-dione |
| Manual Xrefs | Databases |
|---|---|
| CN101463074 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10601737 | Reaxys |
| Citations |
|---|