EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16Br2N4O2 |
| Net Charge | 0 |
| Average Mass | 468.149 |
| Monoisotopic Mass | 465.96400 |
| SMILES | CNc1nc2ccn(C)c(=O)c(Cc3cc(Br)c(OC)c(Br)c3)c-2n1 |
| InChI | InChI=1S/C17H16Br2N4O2/c1-20-17-21-13-4-5-23(2)16(24)10(14(13)22-17)6-9-7-11(18)15(25-3)12(19)8-9/h4-5,7-8H,6H2,1-3H3,(H,20,22) |
| InChIKey | HAIJSTYZBPUVSG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoceratina (ncbitaxon:283601) | - | PubMed (14627391) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceratamine A (CHEBI:65608) has role antimitotic (CHEBI:64911) |
| ceratamine A (CHEBI:65608) has role metabolite (CHEBI:25212) |
| ceratamine A (CHEBI:65608) is a alkaloid (CHEBI:22315) |
| ceratamine A (CHEBI:65608) is a aromatic ether (CHEBI:35618) |
| ceratamine A (CHEBI:65608) is a cyclic ketone (CHEBI:3992) |
| ceratamine A (CHEBI:65608) is a organic heterobicyclic compound (CHEBI:27171) |
| ceratamine A (CHEBI:65608) is a organobromine compound (CHEBI:37141) |
| ceratamine A (CHEBI:65608) is a secondary amino compound (CHEBI:50995) |
| ceratamine A (CHEBI:65608) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 4-(3,5-dibromo-4-methoxybenzyl)-6-methyl-2-(methylamino)imidazo[4,5-d]azepin-5(6H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9655937 | Reaxys |
| Citations |
|---|