EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O3 |
| Net Charge | 0 |
| Average Mass | 458.727 |
| Monoisotopic Mass | 458.37600 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C)C(=O)CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])CC(C)(C)CC[C@]3(CO)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H50O3/c1-19-20(32)8-9-21-26(19,4)11-10-22-27(21,5)13-14-28(6)23-16-25(2,3)12-15-30(23,18-31)24(33)17-29(22,28)7/h19,21-24,31,33H,8-18H2,1-7H3/t19-,21+,22-,23-,24+,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | ZGPGTQGECMDFNI-OJEITCFUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus hindsii (ncbitaxon:489979) | stem (BTO:0001300) | DOI (10.1016/S0031-9422(96)00719-4) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celasdin B (CHEBI:65605) has role anti-HIV agent (CHEBI:64946) |
| celasdin B (CHEBI:65605) has role metabolite (CHEBI:25212) |
| celasdin B (CHEBI:65605) is a cyclic terpene ketone (CHEBI:36130) |
| celasdin B (CHEBI:65605) is a diol (CHEBI:23824) |
| celasdin B (CHEBI:65605) is a pentacyclic triterpenoid (CHEBI:25872) |
| celasdin B (CHEBI:65605) is a primary alcohol (CHEBI:15734) |
| celasdin B (CHEBI:65605) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (4R,4aS,6aS,6bR,8R,8aS,12aS,12bS,14aS,14bS)-8-hydroxy-8a-(hydroxymethyl)-4,4a,6b,11,11,12b,14a-heptamethylicosahydropicen-3(2H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7660622 | Reaxys |
| Citations |
|---|