EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO5 |
| Net Charge | 0 |
| Average Mass | 343.379 |
| Monoisotopic Mass | 343.14197 |
| SMILES | COc1ccc2c(c1O)-c1c(O)c(CCN(C)C)cc(OC)c1C2=O |
| InChI | InChI=1S/C19H21NO5/c1-20(2)8-7-10-9-13(25-4)15-16(17(10)21)14-11(18(15)22)5-6-12(24-3)19(14)23/h5-6,9,21,23H,7-8H2,1-4H3 |
| InChIKey | NDCDKMMCPZJBEB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caulophyllum robustum (ncbitaxon:48401) | - | PubMed (19407969) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caulophine (CHEBI:65604) has role cardiovascular drug (CHEBI:35554) |
| caulophine (CHEBI:65604) has role metabolite (CHEBI:25212) |
| caulophine (CHEBI:65604) is a alkaloid (CHEBI:22315) |
| caulophine (CHEBI:65604) is a aromatic ether (CHEBI:35618) |
| caulophine (CHEBI:65604) is a fluoren-9-ones (CHEBI:24057) |
| caulophine (CHEBI:65604) is a polyphenol (CHEBI:26195) |
| caulophine (CHEBI:65604) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-[2-(dimethylamino)ethyl]-4,5-dihydroxy-1,6-dimethoxy-9H-fluoren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 24750776 | ChemSpider |
| Citations |
|---|