EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H54O10 |
| Net Charge | 0 |
| Average Mass | 634.807 |
| Monoisotopic Mass | 634.37170 |
| SMILES | [H][C@]1(O[C@H]2CC[C@@]3(C)C(=CC[C@]4(O)[C@]3([H])C[C@@H](OC(=O)/C=C(\C)C(C)C)[C@@]3(C)[C@]4(O)CC[C@@]3(O)C(C)=O)C2)C[C@H](OC)[C@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C35H54O10/c1-19(2)20(3)15-28(37)45-27-18-26-31(6)11-10-24(44-29-17-25(42-8)30(38)21(4)43-29)16-23(31)9-12-34(26,40)35(41)14-13-33(39,22(5)36)32(27,35)7/h9,15,19,21,24-27,29-30,38-41H,10-14,16-18H2,1-8H3/b20-15+/t21-,24+,25+,26-,27-,29+,30-,31+,32-,33-,34+,35-/m1/s1 |
| InChIKey | HXGDOYDEDXYRPY-MHKUKWNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cynanchum auriculatum (ncbitaxon:157409) | root (BTO:0001188) | PubMed (18401845) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) has parent hydride pregnane (CHEBI:8386) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) has role antineoplastic agent (CHEBI:35610) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) has role metabolite (CHEBI:25212) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) is a deoxy hexoside (CHEBI:35315) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) is a enoate ester (CHEBI:51702) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) is a methyl ketone (CHEBI:51867) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) is a steroid saponin (CHEBI:61655) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) is a tertiary alcohol (CHEBI:26878) |
| caudatin-3-O-β-cymaropyranoside (CHEBI:65603) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (3β,12β,14β,17α)-3-[(2,6-dideoxy-3-O-methyl-β-D-ribo-hexopyranosyl)oxy]-8,14,17-trihydroxy-20-oxopregn-5-en-12-yl (2E)-3,4-dimethylpent-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15851976 | Reaxys |
| Citations |
|---|