EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O10 |
| Net Charge | 0 |
| Average Mass | 482.441 |
| Monoisotopic Mass | 482.12130 |
| SMILES | COC(=O)C[C@H]1c2cc(O)c(O)cc2Oc2cc(O)c3c(c21)O[C@H](c1ccc(O)c(O)c1)[C@H](O)C3 |
| InChI | InChI=1S/C25H22O10/c1-33-22(32)7-12-11-5-17(29)18(30)9-20(11)34-21-8-15(27)13-6-19(31)24(35-25(13)23(12)21)10-2-3-14(26)16(28)4-10/h2-5,8-9,12,19,24,26-31H,6-7H2,1H3/t12-,19+,24+/m0/s1 |
| InChIKey | XECJBJHITROSPL-WSONZKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichilia catigua (IPNI:579374-1) | bark (BTO:0001301) | PubMed (18020420) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| catiguanin B (CHEBI:65602) has role antioxidant (CHEBI:22586) |
| catiguanin B (CHEBI:65602) has role plant metabolite (CHEBI:76924) |
| catiguanin B (CHEBI:65602) is a catechols (CHEBI:33566) |
| catiguanin B (CHEBI:65602) is a extended flavonoid (CHEBI:71037) |
| catiguanin B (CHEBI:65602) is a methyl ester (CHEBI:25248) |
| catiguanin B (CHEBI:65602) is a organic heterotetracyclic compound (CHEBI:38163) |
| catiguanin B (CHEBI:65602) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| methyl [(2R,3R,12S)-2-(3,4-dihydroxyphenyl)-3,5,9,10-tetrahydroxy-3,4-dihydro-2H,12H-pyrano[2,3-a]xanthen-12-yl]acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15840655 | Reaxys |
| Citations |
|---|