EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N3O6 |
| Net Charge | 0 |
| Average Mass | 365.386 |
| Monoisotopic Mass | 365.15869 |
| SMILES | NCCCCNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H]1O[C@@H]1C(=O)O |
| InChI | InChI=1S/C17H23N3O6/c18-7-1-2-8-19-15(22)12(9-10-3-5-11(21)6-4-10)20-16(23)13-14(26-13)17(24)25/h3-6,12-14,21H,1-2,7-9,18H2,(H,19,22)(H,20,23)(H,24,25)/t12-,13-,14-/m0/s1 |
| InChIKey | JAJMETBQBCMJSZ-IHRRRGAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | - | PubMed (7766039) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cysteine protease inhibitor Any protease inhibitor that restricts the action of a cysteine protease. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cathestatin B (CHEBI:65600) has role Penicillium metabolite (CHEBI:76964) |
| cathestatin B (CHEBI:65600) has role antimicrobial agent (CHEBI:33281) |
| cathestatin B (CHEBI:65600) has role cysteine protease inhibitor (CHEBI:64152) |
| cathestatin B (CHEBI:65600) is a dicarboxylic acid monoamide (CHEBI:35735) |
| cathestatin B (CHEBI:65600) is a epoxide (CHEBI:32955) |
| cathestatin B (CHEBI:65600) is a monocarboxylic acid (CHEBI:25384) |
| cathestatin B (CHEBI:65600) is a phenols (CHEBI:33853) |
| cathestatin B (CHEBI:65600) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (2S,3S)-3-{[(2S)-1-[(4-aminobutyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl}oxirane-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7231119 | Reaxys |
| Citations |
|---|