EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H52O25 |
| Net Charge | 0 |
| Average Mass | 920.820 |
| Monoisotopic Mass | 920.27977 |
| SMILES | [H][C@]1(O[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](CO)O[C@@H](OC[C@H]2O[C@@H](Oc3cc(OC)cc4cc5cc(C)oc(=O)c5c(O)c34)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O |
| InChI | InChI=1S/C39H52O25/c1-11-3-12-4-13-5-14(55-2)6-15(20(13)26(46)21(12)35(54)58-11)59-38-31(51)28(48)23(43)18(62-38)10-57-37-33(53)34(25(45)17(8-41)61-37)64-39-32(52)29(49)24(44)19(63-39)9-56-36-30(50)27(47)22(42)16(7-40)60-36/h3-6,16-19,22-25,27-34,36-53H,7-10H2,1-2H3/t16-,17-,18-,19-,22-,23-,24-,25-,27+,28+,29+,30-,31-,32-,33-,34+,36-,37-,38-,39+/m1/s1 |
| InChIKey | VHWFKCUSOFJPLV-XVRRVUIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cassia obtusifolia (ncbitaxon:346985) | seed (BTO:0001226) | PubMed (9810700) |
| Roles Classification |
|---|
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cassiaside C2 (CHEBI:65598) has role histamine antagonist (CHEBI:37956) |
| cassiaside C2 (CHEBI:65598) has role metabolite (CHEBI:25212) |
| cassiaside C2 (CHEBI:65598) is a aromatic ether (CHEBI:35618) |
| cassiaside C2 (CHEBI:65598) is a isochromenes (CHEBI:38761) |
| cassiaside C2 (CHEBI:65598) is a organic heterotricyclic compound (CHEBI:26979) |
| cassiaside C2 (CHEBI:65598) is a phenols (CHEBI:33853) |
| cassiaside C2 (CHEBI:65598) is a tetrasaccharide derivative (CHEBI:63567) |
| cassiaside C2 (CHEBI:65598) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 10-hydroxy-7-methoxy-3-methyl-1-oxo-1H-benzo[g]isochromen-9-yl β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl-(1→3)-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| toralactone 9-O-β-D-glucopyranosyl-(1→6)-O-β-D-glucopyranosyl- (1→3)-O-β-D-glucopyranosyl-(1→6)-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8251276 | Reaxys |
| Citations |
|---|