EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO4 |
| Net Charge | 0 |
| Average Mass | 313.353 |
| Monoisotopic Mass | 313.13141 |
| SMILES | COC(=O)CCCn1c(C)cc2cc(=O)cc3oc(C)cc1c23 |
| InChI | InChI=1S/C18H19NO4/c1-11-7-13-9-14(20)10-16-18(13)15(8-12(2)23-16)19(11)6-4-5-17(21)22-3/h7-10H,4-6H2,1-3H3 |
| InChIKey | OTLORQJLOJHVHW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Senna siamea (ncbitaxon:346999) | leaf (BTO:0000713) | PubMed (17685627) |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cassiarin B (CHEBI:65597) has role antimalarial (CHEBI:38068) |
| cassiarin B (CHEBI:65597) has role plant metabolite (CHEBI:76924) |
| cassiarin B (CHEBI:65597) is a enone (CHEBI:51689) |
| cassiarin B (CHEBI:65597) is a isoquinoline alkaloid (CHEBI:24921) |
| cassiarin B (CHEBI:65597) is a isoquinolines (CHEBI:24922) |
| cassiarin B (CHEBI:65597) is a methyl ester (CHEBI:25248) |
| cassiarin B (CHEBI:65597) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| methyl 4-(2,5-dimethyl-8-oxopyrano[2,3,4-ij]isoquinolin-4(8H)-yl)butanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11166746 | Reaxys |
| Citations |
|---|