EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O9 |
| Net Charge | 0 |
| Average Mass | 520.619 |
| Monoisotopic Mass | 520.26723 |
| SMILES | [H][C@@]12C[C@@H](OC(=O)CCC)C=C3[C@@H](OC(C)=O)O[C@@H](OC(C)=O)[C@]31[C@@H](O)[C@H](O)[C@@H](C)[C@@]2(C)CCC(=C)C=C |
| InChI | InChI=1S/C28H40O9/c1-8-10-22(31)36-19-13-20-25(34-17(5)29)37-26(35-18(6)30)28(20)21(14-19)27(7,12-11-15(3)9-2)16(4)23(32)24(28)33/h9,13,16,19,21,23-26,32-33H,2-3,8,10-12,14H2,1,4-7H3/t16-,19+,21+,23-,24+,25+,26-,27-,28-/m1/s1 |
| InChIKey | FACSSBRLFWVHQA-OISZFCHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Casearia nigrescens (IPNI:779628-1) | |||
| leaf (BTO:0000713) | PubMed (17315961) | ||
| flower (BTO:0000469) | PubMed (17315961) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caseanigrescen B (CHEBI:65589) has role antineoplastic agent (CHEBI:35610) |
| caseanigrescen B (CHEBI:65589) has role metabolite (CHEBI:25212) |
| caseanigrescen B (CHEBI:65589) is a acetate ester (CHEBI:47622) |
| caseanigrescen B (CHEBI:65589) is a butyrate ester (CHEBI:50477) |
| caseanigrescen B (CHEBI:65589) is a cyclic ether (CHEBI:37407) |
| caseanigrescen B (CHEBI:65589) is a diol (CHEBI:23824) |
| caseanigrescen B (CHEBI:65589) is a diterpenoid (CHEBI:23849) |
| caseanigrescen B (CHEBI:65589) is a organic heterotricyclic compound (CHEBI:26979) |
| caseanigrescen B (CHEBI:65589) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,3R,5R,6aS,7S,8S,9R,10R,10aS)-1,3-bis(acetyloxy)-9,10-dihydroxy-7,8-dimethyl-7-(3-methylidenepent-4-en-1-yl)-3,5,6,6a,7,8,9,10-octahydronaphtho[1,8a-c]furan-5-yl butanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11042049 | Reaxys |
| Citations |
|---|