EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O9 |
| Net Charge | 0 |
| Average Mass | 534.646 |
| Monoisotopic Mass | 534.28288 |
| SMILES | [H][C@]12C[C@@H](OC(=O)C(C)CC)C=C3[C@H](OC(C)=O)O[C@H](OC(C)=O)[C@@]31[C@H](O)C[C@H](C)[C@]2(C)C[C@H](O)C(=C)C=C |
| InChI | InChI=1S/C29H42O9/c1-9-15(3)22(32)14-28(8)17(5)11-24(33)29-21(26(35-18(6)30)38-27(29)36-19(7)31)12-20(13-23(28)29)37-25(34)16(4)10-2/h9,12,16-17,20,22-24,26-27,32-33H,1,3,10-11,13-14H2,2,4-8H3/t16?,17-,20-,22-,23+,24+,26+,27-,28-,29-/m0/s1 |
| InChIKey | FVXRSGIAXHNGNZ-DHKDGQATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Casearia membranacea (IPNI:779616-1) | |||
| twig (BTO:0001411) | PubMed (14709876) | ||
| leaf (BTO:0000713) | PubMed (14709876) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caseamemebrol B (CHEBI:65587) has role antineoplastic agent (CHEBI:35610) |
| caseamemebrol B (CHEBI:65587) has role metabolite (CHEBI:25212) |
| caseamemebrol B (CHEBI:65587) is a acetate ester (CHEBI:47622) |
| caseamemebrol B (CHEBI:65587) is a cyclic ether (CHEBI:37407) |
| caseamemebrol B (CHEBI:65587) is a diol (CHEBI:23824) |
| caseamemebrol B (CHEBI:65587) is a diterpenoid (CHEBI:23849) |
| caseamemebrol B (CHEBI:65587) is a organic heterotricyclic compound (CHEBI:26979) |
| caseamemebrol B (CHEBI:65587) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1R,3S,5R,6aR,7S,8S,10R,10aR)-1,3-bis(acetyloxy)-10-hydroxy-7-[(2S)-2-hydroxy-3-methylidenepent-4-en-1-yl]-7,8-dimethyl-3,5,6,6a,7,8,9,10-octahydronaphtho[1,8a-c]furan-5-yl 2-methylbutanoate |
| Synonym | Source |
|---|---|
| (2R,5R,6R,8S,9S,10R,12S,18S,19R)-18,19-diacetoxy-18,19-epoxy-6-hydroxy-2-(2-methylbutanoyloxy)-cleroda-12-hydroxy-3,13(16),14-triene | ChEBI |
| Citations |
|---|