EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65585 - carnosic acid
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(O)c(O)c3[C@@]1(C(=O)O)CCCC2(C)C |
| InChI | InChI=1S/C20H28O4/c1-11(2)13-10-12-6-7-14-19(3,4)8-5-9-20(14,18(23)24)15(12)17(22)16(13)21/h10-11,14,21-22H,5-9H2,1-4H3,(H,23,24)/t14-,20+/m0/s1 |
| InChIKey | QRYRORQUOLYVBU-VBKZILBWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosmarinus officinalis (ncbitaxon:39367) | leaf (BTO:0000713) | PubMed (8229021) | |
| Salvia officinalis (ncbitaxon:38868) | leaf (BTO:0000713) | DOI (10.1007/BF01201766) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. anti-inflammatory agent Any compound that has anti-inflammatory effects. food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carnosic acid (CHEBI:65585) has role angiogenesis modulating agent (CHEBI:50926) |
| carnosic acid (CHEBI:65585) has role anti-inflammatory agent (CHEBI:67079) |
| carnosic acid (CHEBI:65585) has role antineoplastic agent (CHEBI:35610) |
| carnosic acid (CHEBI:65585) has role antioxidant (CHEBI:22586) |
| carnosic acid (CHEBI:65585) has role apoptosis inducer (CHEBI:68495) |
| carnosic acid (CHEBI:65585) has role food preservative (CHEBI:65255) |
| carnosic acid (CHEBI:65585) has role HIV protease inhibitor (CHEBI:35660) |
| carnosic acid (CHEBI:65585) has role plant metabolite (CHEBI:76924) |
| carnosic acid (CHEBI:65585) is a abietane diterpenoid (CHEBI:36762) |
| carnosic acid (CHEBI:65585) is a carbotricyclic compound (CHEBI:38032) |
| carnosic acid (CHEBI:65585) is a catechols (CHEBI:33566) |
| carnosic acid (CHEBI:65585) is a monocarboxylic acid (CHEBI:25384) |
| carnosic acid (CHEBI:65585) is conjugate acid of carnosate (CHEBI:138943) |
| Incoming Relation(s) |
| carnosate (CHEBI:138943) is conjugate base of carnosic acid (CHEBI:65585) |
| IUPAC Name |
|---|
| 11,12-dihydroxyabieta-8,11,13-trien-20-oic acid |
| Synonyms | Source |
|---|---|
| 11,12-dihydroxy-13-isopropylpodocarpa-8,11,13-trien-17-oic acid | ChEBI |
| (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-(propan-2-yl)-1,3,4,9,10,10a-hexahydrophenanthrene-4a(2H)-carboxylic acid | IUPAC |
| Salvin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Carnosic_acid | Wikipedia |
| CPD-18103 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2707918 | Reaxys |
| CAS:3650-09-7 | ChemIDplus |
| Citations |
|---|