EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O9 |
| Net Charge | 0 |
| Average Mass | 454.516 |
| Monoisotopic Mass | 454.22028 |
| SMILES | [H][C@@]12OC(=O)C(=C)[C@@]1([H])[C@H](OC(=O)C(C)C)C(=O)[C@@H](C)C[C@H](O)C[C@](C)(O)[C@H]2OC(=O)C(C)C |
| InChI | InChI=1S/C23H34O9/c1-10(2)20(26)30-17-15-13(6)22(28)31-18(15)19(32-21(27)11(3)4)23(7,29)9-14(24)8-12(5)16(17)25/h10-12,14-15,17-19,24,29H,6,8-9H2,1-5,7H3/t12-,14-,15-,17-,18+,19-,23-/m0/s1 |
| InChIKey | WOJZAWJFEPVGSB-CHYAZBGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carpesium divaricatum (ncbitaxon:313927) | aerial part (BTO:0001658) | PubMed (9392887) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cardivin D (CHEBI:65579) has role antineoplastic agent (CHEBI:35610) |
| cardivin D (CHEBI:65579) has role metabolite (CHEBI:25212) |
| cardivin D (CHEBI:65579) is a cyclic ketone (CHEBI:3992) |
| cardivin D (CHEBI:65579) is a diol (CHEBI:23824) |
| cardivin D (CHEBI:65579) is a germacranolide (CHEBI:73011) |
| cardivin D (CHEBI:65579) is a secondary alcohol (CHEBI:35681) |
| cardivin D (CHEBI:65579) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3aR,4S,6S,8S,10S,11S,11aR)-8,10-dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxododecahydrocyclodeca[b]furan-4,11-diyl bis(2-methylpropanoate) |
| Synonym | Source |
|---|---|
| 2,10-dihydroxy-5-oxo-6,9-bis(isobutyloxy)germacran-8,12-olide | ChEBI |