EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | [H][C@]12CC[C@@](C)(OC(=O)C1=C)[C@@H](O)CC/C(C)=C/CC[C@](C)(O)[C@H](O)C2 |
| InChI | InChI=1S/C20H32O5/c1-13-6-5-10-19(3,24)17(22)12-15-9-11-20(4,16(21)8-7-13)25-18(23)14(15)2/h6,15-17,21-22,24H,2,5,7-12H2,1,3-4H3/b13-6+/t15-,16+,17-,19+,20-/m1/s1 |
| InChIKey | JLCJNFREUBTKDT-WRHAGOLESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinularia capillosa (WORMS:288499) | - | PubMed (11087604) | |
| Sinularia microclavata (WORMS:288550) | - | PubMed (16038555) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Capillolide (CHEBI:65575) has role metabolite (CHEBI:25212) |
| Capillolide (CHEBI:65575) is a macrolide (CHEBI:25106) |
| Synonym | Source |
|---|---|
| (1R,3R,4S,7E,11S,12R)-3,4,11-trihydroxy-4,8,12-trimethyl-15-methylidene-13-oxabicyclo[10.3.2]heptadec-7-en-14-one | ChEBI |
| Citations |
|---|