EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O5 |
| Net Charge | 0 |
| Average Mass | 458.639 |
| Monoisotopic Mass | 458.30322 |
| SMILES | [H][C@@]12CCC(=C)[C@@H](Cc3c(OC)oc(C)c(C)c3=O)[C@@]1(C)CC[C@@]1([H])O[C@@H](C(C)(C)O)CC[C@@]21C |
| InChI | InChI=1S/C28H42O5/c1-16-9-10-21-27(6,13-12-23-28(21,7)14-11-22(33-23)26(4,5)30)20(16)15-19-24(29)17(2)18(3)32-25(19)31-8/h20-23,30H,1,9-15H2,2-8H3/t20-,21-,22-,23-,27-,28+/m1/s1 |
| InChIKey | JFVQSDWMRIDOHK-RFHSWFGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sesquicillium candelabrum (ncbitaxon:180436) | - | PubMed (11430046) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| candelalide C (CHEBI:65573) has role metabolite (CHEBI:25212) |
| candelalide C (CHEBI:65573) has role potassium channel blocker (CHEBI:50509) |
| candelalide C (CHEBI:65573) is a 4-pyranones (CHEBI:131906) |
| candelalide C (CHEBI:65573) is a cyclic ether (CHEBI:37407) |
| candelalide C (CHEBI:65573) is a diterpenoid (CHEBI:23849) |
| candelalide C (CHEBI:65573) is a ketene acetal (CHEBI:145408) |
| candelalide C (CHEBI:65573) is a organic heterotricyclic compound (CHEBI:26979) |
| candelalide C (CHEBI:65573) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 3-{[(3R,4aR,6aR,7R,10aR,10bS)-3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-8-methylidenedodecahydro-1H-benzo[f]chromen-7-yl]methyl}-2-methoxy-5,6-dimethyl-4H-pyran-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8738976 | Reaxys |
| Citations |
|---|