EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H86O22 |
| Net Charge | 0 |
| Average Mass | 1027.205 |
| Monoisotopic Mass | 1026.56107 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](O[C@@]3([H])[C@H](O[C@H](CCCCCCCCC)CCCCCCCC(C)=O)O[C@H](CO)[C@@H](O)[C@@H]3O)O[C@H](CO[C@@H]3O[C@H](C)[C@H](O)[C@H](O)[C@@H]3O)[C@@H](OC(C)=O)[C@@H]2OC(=O)CCC)O[C@@H](C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C49H86O22/c1-7-9-10-11-12-15-18-22-30(23-19-16-13-14-17-21-26(3)51)66-48-43(39(59)36(56)31(24-50)67-48)70-49-45(71-47-41(61)38(58)35(55)28(5)64-47)44(69-33(53)20-8-2)42(65-29(6)52)32(68-49)25-62-46-40(60)37(57)34(54)27(4)63-46/h27-28,30-32,34-50,54-61H,7-25H2,1-6H3/t27-,28+,30-,31-,32-,34+,35+,36-,37+,38-,39+,40+,41+,42-,43-,44+,45-,46-,47+,48-,49+/m1/s1 |
| InChIKey | XTQWRNIJLVUYJY-ZFMPSFEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caminus sphaeroconia (WORMS:170055) | - | PubMed (12423093) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caminoside A (CHEBI:65570) has role antibacterial agent (CHEBI:33282) |
| caminoside A (CHEBI:65570) has role metabolite (CHEBI:25212) |
| caminoside A (CHEBI:65570) is a acetate ester (CHEBI:47622) |
| caminoside A (CHEBI:65570) is a butyrate ester (CHEBI:50477) |
| caminoside A (CHEBI:65570) is a glycolipid (CHEBI:33563) |
| caminoside A (CHEBI:65570) is a methyl ketone (CHEBI:51867) |
| caminoside A (CHEBI:65570) is a tetrasaccharide derivative (CHEBI:63567) |
| caminoside A (CHEBI:65570) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (10R)-2-oxononadecan-10-yl 6-deoxy-α-L-glucopyranosyl-(1→2)-[6-deoxy-β-D-talopyranosyl-(1→6)]-4-O-acetyl-3-O-butyryl-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9985572 | Reaxys |
| Citations |
|---|