EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38O20 |
| Net Charge | 0 |
| Average Mass | 742.636 |
| Monoisotopic Mass | 742.19564 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](C)O[C@@H](OC[C@H]3O[C@@H](Oc4c(-c5ccc(O)c(O)c5)oc5cc(O)cc(O)c5c4=O)[C@H](O)[C@@H](O)[C@@H]3O)[C@@H]2O)OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C32H38O20/c1-9-19(38)28(51-30-24(43)20(39)15(37)7-46-30)26(45)31(48-9)47-8-17-21(40)23(42)25(44)32(50-17)52-29-22(41)18-14(36)5-11(33)6-16(18)49-27(29)10-2-3-12(34)13(35)4-10/h2-6,9,15,17,19-21,23-26,28,30-40,42-45H,7-8H2,1H3/t9-,15+,17+,19-,20-,21+,23-,24+,25+,26+,28+,30-,31+,32-/m0/s1 |
| InChIKey | GSTBDLJYXUQTFK-FODKTCEYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia japonica (ncbitaxon:4443) | leaf (BTO:0000713) | PubMed (16926516) | Fresh leaves |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| camellianoside (CHEBI:65569) has role metabolite (CHEBI:25212) |
| camellianoside (CHEBI:65569) has role radical scavenger (CHEBI:48578) |
| camellianoside (CHEBI:65569) is a quercetin O-glucoside (CHEBI:64621) |
| camellianoside (CHEBI:65569) is a trisaccharide derivative (CHEBI:63571) |
| camellianoside (CHEBI:65569) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl β-D-xylopyranosyl-(1→3)-6-deoxy-α-L-mannopyranosyl-(1→6)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| quercetin 3-O-β-xylopyranosyl-(1→3)-O-α-L-rhamnopyranosyl-(1→6)-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11115000 | Reaxys |
| Citations |
|---|