EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35Br4ClO |
| Net Charge | 0 |
| Average Mass | 718.634 |
| Monoisotopic Mass | 713.91099 |
| SMILES | [H][C@]12CCC(=C)[C@@H](Cc3cc(Br)cc(Br)c3O)[C@]1(C)CC[C@@H](Br)[C@]2(C)CCC(Cl)C(C)(C)Br |
| InChI | InChI=1S/C26H35Br4ClO/c1-15-6-7-20-25(4,18(15)13-16-12-17(27)14-19(28)23(16)32)10-8-21(29)26(20,5)11-9-22(31)24(2,3)30/h12,14,18,20-22,32H,1,6-11,13H2,2-5H3/t18-,20+,21-,22?,25+,26-/m1/s1 |
| InChIKey | NFMVWIXBGOEENC-VJCWLMRASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Callophycus serratus (ncbitaxon:632897) | - | PubMed (17715978) |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| callophycol B (CHEBI:65566) has role antibacterial agent (CHEBI:33282) |
| callophycol B (CHEBI:65566) has role antimalarial (CHEBI:38068) |
| callophycol B (CHEBI:65566) has role antineoplastic agent (CHEBI:35610) |
| callophycol B (CHEBI:65566) has role metabolite (CHEBI:25212) |
| callophycol B (CHEBI:65566) is a carbobicyclic compound (CHEBI:36785) |
| callophycol B (CHEBI:65566) is a dibromophenol (CHEBI:33625) |
| callophycol B (CHEBI:65566) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2,4-dibromo-6-{[(1R,4aS,5R,6R,8aS)-6-bromo-5-(4-bromo-3-chloro-4-methylpentyl)-5,8a-dimethyl-2-methylidenedecahydronaphthalen-1-yl]methyl}phenol |
| Manual Xrefs | Databases |
|---|---|
| 27023088 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11167770 | Reaxys |
| Citations |
|---|