EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36Br2O3 |
| Net Charge | 0 |
| Average Mass | 568.390 |
| Monoisotopic Mass | 566.10312 |
| SMILES | [H][C@]12CCC(=C)[C@@H](Cc3cc(C(=O)O)cc(Br)c3O)[C@]1(C)CC[C@@H](Br)[C@]2(C)CCC=C(C)C |
| InChI | InChI=1S/C27H36Br2O3/c1-16(2)7-6-11-27(5)22-9-8-17(3)20(26(22,4)12-10-23(27)29)14-18-13-19(25(31)32)15-21(28)24(18)30/h7,13,15,20,22-23,30H,3,6,8-12,14H2,1-2,4-5H3,(H,31,32)/t20-,22+,23-,26+,27-/m1/s1 |
| InChIKey | JGBUIUFDBKKZNT-WBNSUDINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Callophycus serratus (ncbitaxon:632897) | - | PubMed (17715978) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| callophycoic acid H (CHEBI:65564) has role antibacterial agent (CHEBI:33282) |
| callophycoic acid H (CHEBI:65564) has role antimalarial (CHEBI:38068) |
| callophycoic acid H (CHEBI:65564) has role antineoplastic agent (CHEBI:35610) |
| callophycoic acid H (CHEBI:65564) has role metabolite (CHEBI:25212) |
| callophycoic acid H (CHEBI:65564) is a carbobicyclic compound (CHEBI:36785) |
| callophycoic acid H (CHEBI:65564) is a diterpenoid (CHEBI:23849) |
| callophycoic acid H (CHEBI:65564) is a monohydroxybenzoic acid (CHEBI:25389) |
| callophycoic acid H (CHEBI:65564) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| 3-bromo-5-{[(1R,4aS,5R,6R,8aS)-6-bromo-5,8a-dimethyl-2-methylidene-5-(4-methyl-3-penten-1-yl)decahydro-1-naphthalenyl]methyl}-4-hydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 27023093 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11167778 | Reaxys |
| Citations |
|---|