EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O5 |
| Net Charge | 0 |
| Average Mass | 370.445 |
| Monoisotopic Mass | 370.17802 |
| SMILES | CCCc1cc(=O)oc2c3c(c4c(c12)OC(C)(C)C=C4)O[C@H](C)[C@@H](C)[C@@H]3O |
| InChI | InChI=1S/C22H26O5/c1-6-7-13-10-15(23)26-21-16(13)20-14(8-9-22(4,5)27-20)19-17(21)18(24)11(2)12(3)25-19/h8-12,18,24H,6-7H2,1-5H3/t11-,12-,18+/m1/s1 |
| InChIKey | NIDRYBLTWYFCFV-FMTVUPSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calophyllum brasiliense (IPNI:427115-1) | leaf (BTO:0000713) | PubMed (15340243) | |
| Calophyllum lanigerum var. austrocoriaceum (IPNI:876292-1) | |||
| twig (BTO:0001411) | PubMed (9784162) | ||
| fruit (BTO:0000486) | PubMed (9784162) |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-calanolide A (CHEBI:65552) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| (+)-calanolide A (CHEBI:65552) has role plant metabolite (CHEBI:76924) |
| (+)-calanolide A (CHEBI:65552) is a cyclic ether (CHEBI:37407) |
| (+)-calanolide A (CHEBI:65552) is a organic heterotetracyclic compound (CHEBI:38163) |
| (+)-calanolide A (CHEBI:65552) is a secondary alcohol (CHEBI:35681) |
| (+)-calanolide A (CHEBI:65552) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (10R,11S,12S)-12-hydroxy-6,6,10,11-tetramethyl-4-propyl-11,12-dihydro-2H,6H,10H-dipyrano[2,3-f:2',3'-h]chromen-2-one |
| Synonyms | Source |
|---|---|
| (+)-(10R,11S,12S)-10,11-trans-dihydro-12-hydroxy-6,6,10,11-tetramethyl-4-propyl-2H,6H-benzo[1,2-b:3,4-b':5,6-b'']tripyran-2-one | ChEBI |
| (10R,11S,12S)-11,12-dihydro-12-hydroxy-6,6,10,11-tetramethyl-4-propyl-2H,6H,10H-benzo(1,2-b:3,4-b':5,6-b'')tripyran-2-one | ChEBI |
| calanolide A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5856917 | Reaxys |
| CAS:142632-32-4 | ChemIDplus |
| CAS:142632-32-4 | KEGG COMPOUND |
| Citations |
|---|