EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O6 |
| Net Charge | 0 |
| Average Mass | 252.222 |
| Monoisotopic Mass | 252.06339 |
| SMILES | COC(=O)COC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H12O6/c1-17-12(16)7-18-11(15)5-3-8-2-4-9(13)10(14)6-8/h2-6,13-14H,7H2,1H3/b5-3+ |
| InChIKey | BTLDPXVDOAPOIR-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parthenocissus tricuspidata (ncbitaxon:345127) | leaf (BTO:0000713) | PubMed (15089035) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caffeoylglycolic acid methyl ester (CHEBI:65548) has functional parent trans-caffeic acid (CHEBI:16433) |
| caffeoylglycolic acid methyl ester (CHEBI:65548) has functional parent glycolic acid (CHEBI:17497) |
| caffeoylglycolic acid methyl ester (CHEBI:65548) has role plant metabolite (CHEBI:76924) |
| caffeoylglycolic acid methyl ester (CHEBI:65548) has role radical scavenger (CHEBI:48578) |
| caffeoylglycolic acid methyl ester (CHEBI:65548) is a catechols (CHEBI:33566) |
| caffeoylglycolic acid methyl ester (CHEBI:65548) is a cinnamate ester (CHEBI:36087) |
| caffeoylglycolic acid methyl ester (CHEBI:65548) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| 2-methoxy-2-oxoethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11261689 | Reaxys |
| Citations |
|---|