EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@@]12CCC(C)=CC[C@@]1(C)C[C@H](O)[C@@]2(O)C(C)C |
| InChI | InChI=1S/C15H26O2/c1-10(2)15(17)12-6-5-11(3)7-8-14(12,4)9-13(15)16/h7,10,12-13,16-17H,5-6,8-9H2,1-4H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | WBVHJGBFCZGJRZ-CBBWQLFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gliocladium virens (ncbitaxon:29875) | - | PubMed (2292685) | Strain: IFO 9166 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CAF-603 (CHEBI:65546) has role antifungal agent (CHEBI:35718) |
| CAF-603 (CHEBI:65546) has role metabolite (CHEBI:25212) |
| CAF-603 (CHEBI:65546) is a carbobicyclic compound (CHEBI:36785) |
| CAF-603 (CHEBI:65546) is a secondary alcohol (CHEBI:35681) |
| CAF-603 (CHEBI:65546) is a sesquiterpenoid (CHEBI:26658) |
| CAF-603 (CHEBI:65546) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,2S,3aS,8aR)-3a,6-dimethyl-1-(propan-2-yl)-1,2,3,3a,4,7,8,8a-octahydroazulene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| CAS:105772-90-5 | ChemIDplus |
| Citations |
|---|