EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O6 |
| Net Charge | 0 |
| Average Mass | 420.546 |
| Monoisotopic Mass | 420.25119 |
| SMILES | C=CC(O)C#CC#C/C=C/C(OC)C(OCCCCC(=O)OC)C(O)CCCCC |
| InChI | InChI=1S/C24H36O6/c1-5-7-10-16-21(26)24(30-19-14-13-18-23(27)29-4)22(28-3)17-12-9-8-11-15-20(25)6-2/h6,12,17,20-22,24-26H,2,5,7,10,13-14,16,18-19H2,1,3-4H3/b17-12+ |
| InChIKey | LCCGCXCFZHBCJT-SFQUDFHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | aerial part (BTO:0001658) | PubMed (17520525) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cadiyenol (CHEBI:65538) has role antineoplastic agent (CHEBI:35610) |
| cadiyenol (CHEBI:65538) has role apoptosis inducer (CHEBI:68495) |
| cadiyenol (CHEBI:65538) has role metabolite (CHEBI:25212) |
| cadiyenol (CHEBI:65538) is a acetylenic compound (CHEBI:73474) |
| cadiyenol (CHEBI:65538) is a diether (CHEBI:46786) |
| cadiyenol (CHEBI:65538) is a diol (CHEBI:23824) |
| cadiyenol (CHEBI:65538) is a methyl ester (CHEBI:25248) |
| cadiyenol (CHEBI:65538) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| methyl 5-{[(9E)-6,15-dihydroxy-8-methoxyheptadeca-9,16-diene-11,13-diyn-7-yl]oxy}pentanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11222769 | Reaxys |
| Citations |
|---|