EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O6 |
| Net Charge | 0 |
| Average Mass | 420.546 |
| Monoisotopic Mass | 420.25119 |
| SMILES | C=CC(O)C#CC#C/C=C/C(OC)C(OCCCCC(=O)OC)C(O)CCCCC |
| InChI | InChI=1S/C24H36O6/c1-5-7-10-16-21(26)24(30-19-14-13-18-23(27)29-4)22(28-3)17-12-9-8-11-15-20(25)6-2/h6,12,17,20-22,24-26H,2,5,7,10,13-14,16,18-19H2,1,3-4H3/b17-12+ |
| InChIKey | LCCGCXCFZHBCJT-SFQUDFHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | aerial part (BTO:0001658) | PubMed (17520525) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cadiyenol (CHEBI:65538) has role antineoplastic agent (CHEBI:35610) |
| cadiyenol (CHEBI:65538) has role apoptosis inducer (CHEBI:68495) |
| cadiyenol (CHEBI:65538) has role metabolite (CHEBI:25212) |
| cadiyenol (CHEBI:65538) is a acetylenic compound (CHEBI:73474) |
| cadiyenol (CHEBI:65538) is a diether (CHEBI:46786) |
| cadiyenol (CHEBI:65538) is a diol (CHEBI:23824) |
| cadiyenol (CHEBI:65538) is a methyl ester (CHEBI:25248) |
| cadiyenol (CHEBI:65538) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| methyl 5-{[(9E)-6,15-dihydroxy-8-methoxyheptadeca-9,16-diene-11,13-diyn-7-yl]oxy}pentanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11222769 | Reaxys |
| Citations |
|---|