EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO2 |
| Net Charge | 0 |
| Average Mass | 297.398 |
| Monoisotopic Mass | 297.17288 |
| SMILES | C=CC(C)(C)C1(CC=C(C)C)C(=O)Nc2ccccc2C1=O |
| InChI | InChI=1S/C19H23NO2/c1-6-18(4,5)19(12-11-13(2)3)16(21)14-9-7-8-10-15(14)20-17(19)22/h6-11H,1,12H2,2-5H3,(H,20,22) |
| InChIKey | LAXFAGHIJVQGNK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euodia roxburghiana (IPNI:773124-1) | - | PubMed (8778237) | |
| Haplophyllum tuberculatum (ncbitaxon:452784) | - | DOI (10.1016/S0031-9422(00)82500-5) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Buchapine (CHEBI:65535) has role metabolite (CHEBI:25212) |
| Buchapine (CHEBI:65535) is a quinolines (CHEBI:26513) |
| Synonym | Source |
|---|---|
| 3-(3-Methyl-2-butenyl)-3-(1,1-dimethyl-2-propenyl)-1,2,3,4-tetrahydro-2,4-quinolinedione | ChEBI |
| Citations |
|---|