EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O11 |
| Net Charge | 0 |
| Average Mass | 480.466 |
| Monoisotopic Mass | 480.16316 |
| SMILES | [H][C@]12[C@@H](O)[C@H](O)[C@]3(C(=O)OC)OC[C@]14[C@@]3([H])[C@@H](OC(C)=O)C(=O)O[C@]4([H])C[C@@]1([H])C(C)=C(O)C(=O)C[C@]21C |
| InChI | InChI=1S/C23H28O11/c1-8-10-5-12-22-7-32-23(20(30)31-4,17(22)15(19(29)34-12)33-9(2)24)18(28)14(27)16(22)21(10,3)6-11(25)13(8)26/h10,12,14-18,26-28H,5-7H2,1-4H3/t10-,12+,14+,15+,16+,17+,18-,21-,22+,23+/m0/s1 |
| InChIKey | YDWODLQEUPYKGJ-MUVFDYEFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brucea javanica (ncbitaxon:210348) | fruit (BTO:0000486) | DOI (10.1016/S1383-5769(99)00023-9) | |
| Brucea sumatrana (IPNI:813620-1) | - | Article (DUOC HOC, 1979,4,15) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-O-acetylbruceolide (CHEBI:65530) has functional parent bruceolide (CHEBI:65529) |
| 15-O-acetylbruceolide (CHEBI:65530) has role antifeedant (CHEBI:22583) |
| 15-O-acetylbruceolide (CHEBI:65530) has role plant metabolite (CHEBI:76924) |
| 15-O-acetylbruceolide (CHEBI:65530) is a acetate ester (CHEBI:47622) |
| 15-O-acetylbruceolide (CHEBI:65530) is a cyclic ether (CHEBI:37407) |
| 15-O-acetylbruceolide (CHEBI:65530) is a enol (CHEBI:33823) |
| 15-O-acetylbruceolide (CHEBI:65530) is a enone (CHEBI:51689) |
| 15-O-acetylbruceolide (CHEBI:65530) is a methyl ester (CHEBI:25248) |
| 15-O-acetylbruceolide (CHEBI:65530) is a organic heteropentacyclic compound (CHEBI:38164) |
| 15-O-acetylbruceolide (CHEBI:65530) is a quassinoid (CHEBI:72485) |
| 15-O-acetylbruceolide (CHEBI:65530) is a triol (CHEBI:27136) |
| 15-O-acetylbruceolide (CHEBI:65530) is a δ-lactone (CHEBI:18946) |
| Synonym | Source |
|---|---|
| brucein B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9173717 | Reaxys |
| Citations |
|---|