EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O11 |
| Net Charge | 0 |
| Average Mass | 550.601 |
| Monoisotopic Mass | 550.24141 |
| SMILES | [H][C@]12[C@@H](O)[C@H](O)[C@@]3(C(=O)OC)OC[C@]14[C@@]3([H])[C@@H](OC(=O)/C=C(\C)C(C)C)C(=O)O[C@]4([H])C[C@@]1([H])[C@H](C)CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C28H38O11/c1-11(2)12(3)8-17(30)39-19-21-27-10-37-28(21,25(35)36-6)23(33)18(31)20(27)26(5)14(9-16(27)38-24(19)34)13(4)7-15(29)22(26)32/h8,11,13-14,16,18-23,31-33H,7,9-10H2,1-6H3/b12-8+/t13-,14+,16-,18-,19-,20-,21-,22-,23+,26+,27-,28+/m1/s1 |
| InChIKey | SXRILXHNZYONKW-XZXXSJTKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brucea antidysenterica (ncbitaxon:459111) | xylem (BTO:0001468) | PubMed (8133299) | Previous component: ground wood; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bruceanol E (CHEBI:65527) has role antineoplastic agent (CHEBI:35610) |
| bruceanol E (CHEBI:65527) has role metabolite (CHEBI:25212) |
| bruceanol E (CHEBI:65527) is a cyclic ether (CHEBI:37407) |
| bruceanol E (CHEBI:65527) is a enoate ester (CHEBI:51702) |
| bruceanol E (CHEBI:65527) is a methyl ester (CHEBI:25248) |
| bruceanol E (CHEBI:65527) is a organic heteropentacyclic compound (CHEBI:38164) |
| bruceanol E (CHEBI:65527) is a pentacyclic triterpenoid (CHEBI:25872) |
| bruceanol E (CHEBI:65527) is a quassinoid (CHEBI:72485) |
| bruceanol E (CHEBI:65527) is a secondary α-hydroxy ketone (CHEBI:2468) |
| bruceanol E (CHEBI:65527) is a triol (CHEBI:27136) |
| bruceanol E (CHEBI:65527) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| methyl (1β,11β,12α,15β)-15-{[(2E)-3,4-dimethylpent-2-enoyl]oxy}-1,11,12-trihydroxy-2,16-dioxo-13,20-epoxypicrasan-21-oate |
| Registry Numbers | Sources |
|---|---|
| CAS:152645-85-7 | ChemIDplus |
| Citations |
|---|