EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11BrN2O |
| Net Charge | 0 |
| Average Mass | 291.148 |
| Monoisotopic Mass | 290.00548 |
| SMILES | COc1ccc(Br)c2c1nc1c(C)nccc12 |
| InChI | InChI=1S/C13H11BrN2O/c1-7-12-8(5-6-15-7)11-9(14)3-4-10(17-2)13(11)16-12/h3-6,16H,1-2H3 |
| InChIKey | OVNRKQHNHZRXHF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterocella vesiculosa (WORMS:467054) | - | PubMed (19220033) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-bromo-8-methoxy-1-methyl-β-carboline (CHEBI:65524) has role antibacterial agent (CHEBI:33282) |
| 5-bromo-8-methoxy-1-methyl-β-carboline (CHEBI:65524) has role antifungal agent (CHEBI:35718) |
| 5-bromo-8-methoxy-1-methyl-β-carboline (CHEBI:65524) has role antineoplastic agent (CHEBI:35610) |
| 5-bromo-8-methoxy-1-methyl-β-carboline (CHEBI:65524) has role metabolite (CHEBI:25212) |
| 5-bromo-8-methoxy-1-methyl-β-carboline (CHEBI:65524) is a alkaloid (CHEBI:22315) |
| 5-bromo-8-methoxy-1-methyl-β-carboline (CHEBI:65524) is a aromatic ether (CHEBI:35618) |
| 5-bromo-8-methoxy-1-methyl-β-carboline (CHEBI:65524) is a organobromine compound (CHEBI:37141) |
| 5-bromo-8-methoxy-1-methyl-β-carboline (CHEBI:65524) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| 5-bromo-8-methoxy-1-methyl-9H-β-carboline |
| Citations |
|---|