EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24O7 |
| Net Charge | 0 |
| Average Mass | 424.449 |
| Monoisotopic Mass | 424.15220 |
| SMILES | [H][C@@]1(C(O)Cc2c3c(c(O)c4c(=O)c5cc(O)ccc5oc24)C=CC(C)(C)O3)OC1(C)C |
| InChI | InChI=1S/C24H24O7/c1-23(2)8-7-12-18(27)17-19(28)13-9-11(25)5-6-16(13)29-21(17)14(20(12)30-23)10-15(26)22-24(3,4)31-22/h5-9,15,22,25-27H,10H2,1-4H3/t15?,22-/m0/s1 |
| InChIKey | IMTVDLTVVRHMPA-CEISFSOZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calophyllum brasiliense (IPNI:427115-1) | stem (BTO:0001300) | PubMed (11908963) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brasixanthone D (CHEBI:65521) has role antineoplastic agent (CHEBI:35610) |
| brasixanthone D (CHEBI:65521) has role metabolite (CHEBI:25212) |
| brasixanthone D (CHEBI:65521) is a epoxide (CHEBI:32955) |
| brasixanthone D (CHEBI:65521) is a polyphenol (CHEBI:26195) |
| brasixanthone D (CHEBI:65521) is a pyranoxanthones (CHEBI:71238) |
| brasixanthone D (CHEBI:65521) is a secondary alcohol (CHEBI:35681) |
| Synonym | Source |
|---|---|
| 12-{[(2S)-3,3-dimethyloxiran-2-yl](hydroxy)methyl}-5,8-dihydroxy-2,2-dimethyl-2H,6H-pyrano[3,2-b]xanthen-6-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 10269291 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9089726 | Reaxys |
| Citations |
|---|