EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O5 |
| Net Charge | 0 |
| Average Mass | 350.370 |
| Monoisotopic Mass | 350.11542 |
| SMILES | CC[C@@H]1CC(=O)c2c(cc(O)c3c2C(=O)c2cccc(OC)c2C3=O)C1 |
| InChI | InChI=1S/C21H18O5/c1-3-10-7-11-9-14(23)18-19(16(11)13(22)8-10)20(24)12-5-4-6-15(26-2)17(12)21(18)25/h4-6,9-10,23H,3,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | JCMDNBJXOUWFMR-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia brasiliensis (ncbitaxon:37326) | - | PubMed (9066761) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brasiliquinone C (CHEBI:65518) has role antibacterial agent (CHEBI:33282) |
| brasiliquinone C (CHEBI:65518) has role antimicrobial agent (CHEBI:33281) |
| brasiliquinone C (CHEBI:65518) has role antineoplastic agent (CHEBI:35610) |
| brasiliquinone C (CHEBI:65518) has role metabolite (CHEBI:25212) |
| brasiliquinone C (CHEBI:65518) is a p-quinones (CHEBI:25830) |
| brasiliquinone C (CHEBI:65518) is a aromatic ether (CHEBI:35618) |
| brasiliquinone C (CHEBI:65518) is a carbopolycyclic compound (CHEBI:35294) |
| brasiliquinone C (CHEBI:65518) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (3S)-3-ethyl-6-hydroxy-8-methoxy-3,4-dihydrotetraphene-1,7,12(2H)-trione |
| Manual Xrefs | Databases |
|---|---|
| 8648465 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7544861 | Reaxys |
| Citations |
|---|