EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O5 |
| Net Charge | 0 |
| Average Mass | 350.370 |
| Monoisotopic Mass | 350.11542 |
| SMILES | CC[C@@H]1CC(=O)c2c(cc(O)c3c2C(=O)c2cccc(OC)c2C3=O)C1 |
| InChI | InChI=1S/C21H18O5/c1-3-10-7-11-9-14(23)18-19(16(11)13(22)8-10)20(24)12-5-4-6-15(26-2)17(12)21(18)25/h4-6,9-10,23H,3,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | JCMDNBJXOUWFMR-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia brasiliensis (ncbitaxon:37326) | - | PubMed (9066761) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brasiliquinone C (CHEBI:65518) has role antibacterial agent (CHEBI:33282) |
| brasiliquinone C (CHEBI:65518) has role antimicrobial agent (CHEBI:33281) |
| brasiliquinone C (CHEBI:65518) has role antineoplastic agent (CHEBI:35610) |
| brasiliquinone C (CHEBI:65518) has role metabolite (CHEBI:25212) |
| brasiliquinone C (CHEBI:65518) is a p-quinones (CHEBI:25830) |
| brasiliquinone C (CHEBI:65518) is a aromatic ether (CHEBI:35618) |
| brasiliquinone C (CHEBI:65518) is a carbopolycyclic compound (CHEBI:35294) |
| brasiliquinone C (CHEBI:65518) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (3S)-3-ethyl-6-hydroxy-8-methoxy-3,4-dihydrotetraphene-1,7,12(2H)-trione |
| Manual Xrefs | Databases |
|---|---|
| 8648465 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7544861 | Reaxys |
| Citations |
|---|