EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O5 |
| Net Charge | 0 |
| Average Mass | 378.424 |
| Monoisotopic Mass | 378.14672 |
| SMILES | C=CC(C)(C)c1c2c(c(O)c3c(=O)c4cccc(O)c4oc13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C23H22O5/c1-6-22(2,3)16-20-13(10-11-23(4,5)28-20)18(26)15-17(25)12-8-7-9-14(24)19(12)27-21(15)16/h6-11,24,26H,1H2,2-5H3 |
| InChIKey | VCRGQEOJJJBBNZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calophyllum blancoi (ncbitaxon:667324) | root (BTO:0001188) | PubMed (15684529) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| blancoxanthone (CHEBI:65511) has role antiviral agent (CHEBI:22587) |
| blancoxanthone (CHEBI:65511) has role metabolite (CHEBI:25212) |
| blancoxanthone (CHEBI:65511) is a polyphenol (CHEBI:26195) |
| blancoxanthone (CHEBI:65511) is a pyranoxanthones (CHEBI:71238) |
| IUPAC Name |
|---|
| 5,10-dihydroxy-2,2-dimethyl-12-(2-methylbut-3-en-2-yl)-2H,6H-pyrano[3,2-b]xanthen-6-one |
| Synonym | Source |
|---|---|
| inoxanthone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6826493 | Reaxys |
| Citations |
|---|