EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H38O4 |
| Net Charge | 0 |
| Average Mass | 474.641 |
| Monoisotopic Mass | 474.27701 |
| SMILES | [H][C@@]12C(C)=CC[C@]([H])([C@H](C)CCC=C(C)C)[C@]1([H])[C@]1([H])C(=O)[C@@]3(O[C@]21c1ccccc1)C(=O)OC[C@@]3(C)C=C |
| InChI | InChI=1S/C31H38O4/c1-7-29(6)18-34-28(33)31(29)27(32)26-24-23(20(4)13-11-12-19(2)3)17-16-21(5)25(24)30(26,35-31)22-14-9-8-10-15-22/h7-10,12,14-16,20,23-26H,1,11,13,17-18H2,2-6H3/t20-,23-,24+,25-,26-,29-,30-,31-/m1/s1 |
| InChIKey | HPOOJUSGIAKESV-FUPDMQGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum chinense var. salicifolium (IPNI:433826-1) | leaf (BTO:0000713) | PubMed (15987189) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Biyouyanagin A (CHEBI:65510) has role metabolite (CHEBI:25212) |
| Biyouyanagin A (CHEBI:65510) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| (2R,3aS,3bS,4R,4'R,7aS,7bR)-4',7-Dimethyl-4-[(2R)-6-methyl-5-hepten-2-yl]-7b-phenyl-4'-vinyl-3a,3b,4,4',5,5',7a,7b-octahydro-3H-spiro[benzo[3,4]cyclobuta[1,2-b]furan-2,3'-furan]-2',3-dione | ChEBI |
| Citations |
|---|