EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36N6O6S |
| Net Charge | 0 |
| Average Mass | 548.666 |
| Monoisotopic Mass | 548.24170 |
| SMILES | [H][C@@]1([C@@H](C)O)NC(=O)[C@H](C(C)C)NC(=O)c2csc(n2)[C@H](C(C)C)NC(=O)c2coc(n2)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C25H36N6O6S/c1-10(2)16-22(35)31-19(13(7)32)23(36)29-17(11(3)4)24-26-14(8-37-24)20(33)30-18(12(5)6)25-27-15(9-38-25)21(34)28-16/h8-13,16-19,32H,1-7H3,(H,28,34)(H,29,36)(H,30,33)(H,31,35)/t13-,16+,17+,18+,19+/m1/s1 |
| InChIKey | LDXCESZYUWPDOR-RUZYHRDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lissoclinum bistratum (ncbitaxon:322849) | - | PubMed (12608858) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bistratamide I (CHEBI:65508) has role antineoplastic agent (CHEBI:35610) |
| bistratamide I (CHEBI:65508) has role metabolite (CHEBI:25212) |
| bistratamide I (CHEBI:65508) is a 1,3-oxazoles (CHEBI:46812) |
| bistratamide I (CHEBI:65508) is a 1,3-thiazoles (CHEBI:38418) |
| bistratamide I (CHEBI:65508) is a homodetic cyclic peptide (CHEBI:24613) |
| bistratamide I (CHEBI:65508) is a macrocycle (CHEBI:51026) |
| bistratamide I (CHEBI:65508) is a organic heterotricyclic compound (CHEBI:26979) |
| bistratamide I (CHEBI:65508) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (4S,11S,14S,17S)-14-[(1R)-1-hydroxyethyl]-4,11,17-tri(propan-2-yl)-19-oxa-6-thia-3,10,13,16,21,22-hexaazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,12,15-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 9267985 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9455915 | Reaxys |
| Citations |
|---|