EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N6O4S2 |
| Net Charge | 0 |
| Average Mass | 546.719 |
| Monoisotopic Mass | 546.20830 |
| SMILES | [H][C@]12N=C(O[C@@H]1C)[C@H](C(C)C)NC(=O)c1csc(n1)[C@H](C(C)C)NC(=O)c1csc(n1)[C@H](C(C)C)NC2=O |
| InChI | InChI=1S/C25H34N6O4S2/c1-10(2)16-23-31-19(13(7)35-23)22(34)30-18(12(5)6)25-27-15(9-37-25)21(33)29-17(11(3)4)24-26-14(8-36-24)20(32)28-16/h8-13,16-19H,1-7H3,(H,28,32)(H,29,33)(H,30,34)/t13-,16+,17+,18+,19+/m1/s1 |
| InChIKey | USFFWHGVKNECEY-RUZYHRDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lissoclinum bistratum (ncbitaxon:322849) | - | PubMed (12608858) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bistratamide E (CHEBI:65504) has role antineoplastic agent (CHEBI:35610) |
| bistratamide E (CHEBI:65504) has role metabolite (CHEBI:25212) |
| bistratamide E (CHEBI:65504) is a homodetic cyclic peptide (CHEBI:24613) |
| bistratamide E (CHEBI:65504) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (4S,7R,8S,11S,18S)-7-methyl-4,11,18-tri(propan-2-yl)-6-oxa-13,20-dithia-3,10,17,22,23,24-hexaazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),12(23),14,19(22)-pentaene-2,9,16-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9451984 | Reaxys |
| Citations |
|---|