EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O3 |
| Net Charge | 0 |
| Average Mass | 292.334 |
| Monoisotopic Mass | 292.10994 |
| SMILES | O=C(/C=C/C=C/C=C/c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H16O3/c20-17-11-7-15(8-12-17)5-3-1-2-4-6-19(22)16-9-13-18(21)14-10-16/h1-14,20-21H/b2-1+,5-3+,6-4+ |
| InChIKey | WRCGSWXFJPRBPO-CRQXNEITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Etlingera elatior (ncbitaxon:188493) | rhizome (BTO:0001181) | PubMed (15730265) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-bis-(4-hydroxyphenyl)-2,4,6-heptatrienone (CHEBI:65503) has role antioxidant (CHEBI:22586) |
| 1,7-bis-(4-hydroxyphenyl)-2,4,6-heptatrienone (CHEBI:65503) has role metabolite (CHEBI:25212) |
| 1,7-bis-(4-hydroxyphenyl)-2,4,6-heptatrienone (CHEBI:65503) is a aromatic ketone (CHEBI:76224) |
| 1,7-bis-(4-hydroxyphenyl)-2,4,6-heptatrienone (CHEBI:65503) is a enone (CHEBI:51689) |
| 1,7-bis-(4-hydroxyphenyl)-2,4,6-heptatrienone (CHEBI:65503) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2E,4E,6E)-1,7-bis(4-hydroxyphenyl)hepta-2,4,6-trien-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15768992 | Reaxys |
| Citations |
|---|