EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O2S |
| Net Charge | 0 |
| Average Mass | 246.331 |
| Monoisotopic Mass | 246.07145 |
| SMILES | Oc1ccc(CSCc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C14H14O2S/c15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h1-8,15-16H,9-10H2 |
| InChIKey | OEISQDWSEZCYNH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gastrodia elata (ncbitaxon:91201) | - | PubMed (17381154) | |
| Pleuropterus ciliinervis (IPNI:695248-1) | root (BTO:0001188) | PubMed (17851433) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) has role metabolite (CHEBI:25212) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) has role neuroprotective agent (CHEBI:63726) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) is a organic sulfide (CHEBI:16385) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4,4'-(sulfanediyldimethanediyl)diphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2459138 | Reaxys |
| Citations |
|---|