EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O2S |
| Net Charge | 0 |
| Average Mass | 246.331 |
| Monoisotopic Mass | 246.07145 |
| SMILES | Oc1ccc(CSCc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C14H14O2S/c15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h1-8,15-16H,9-10H2 |
| InChIKey | OEISQDWSEZCYNH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gastrodia elata (ncbitaxon:91201) | - | PubMed (17381154) | |
| Pleuropterus ciliinervis (IPNI:695248-1) | root (BTO:0001188) | PubMed (17851433) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) has role metabolite (CHEBI:25212) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) has role neuroprotective agent (CHEBI:63726) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) is a organic sulfide (CHEBI:16385) |
| bis-(4-hydroxybenzyl)sulfide (CHEBI:65500) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4,4'-(sulfanediyldimethanediyl)diphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2459138 | Reaxys |
| Citations |
|---|