EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29N5O2 |
| Net Charge | 0 |
| Average Mass | 359.474 |
| Monoisotopic Mass | 359.23213 |
| SMILES | Cn1nc(CO)nc1NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C19H29N5O2/c1-23-19(21-18(15-25)22-23)20-9-6-12-26-17-8-5-7-16(13-17)14-24-10-3-2-4-11-24/h5,7-8,13,25H,2-4,6,9-12,14-15H2,1H3,(H,20,21,22) |
| InChIKey | VTLNPNNUIJHJQB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| Application: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loxtidine (CHEBI:6550) has role H2-receptor antagonist (CHEBI:37961) |
| loxtidine (CHEBI:6550) is a aromatic ether (CHEBI:35618) |
| loxtidine (CHEBI:6550) is a piperidines (CHEBI:26151) |
| loxtidine (CHEBI:6550) is a primary alcohol (CHEBI:15734) |
| loxtidine (CHEBI:6550) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| [1-methyl-5-({3-[3-(piperidin-1-ylmethyl)phenoxy]propyl}amino)-1H-1,2,4-triazol-3-yl]methanol |
| INNs | Source |
|---|---|
| lavoltidina | ChemIDplus |
| lavoltidine | ChemIDplus |
| lavoltidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| AH-23844 FREE BASE | ChEMBL |
| lavoltidine | ChEMBL |
| Lavoltidine | KEGG COMPOUND |
| Loxtidina | ChemIDplus |
| Loxtidine | KEGG COMPOUND |
| Loxtidinum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6876968 | Reaxys |
| CAS:76956-02-0 | ChemIDplus |
| CAS:76956-02-0 | KEGG COMPOUND |
| Citations |
|---|