EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O5 |
| Net Charge | 0 |
| Average Mass | 410.510 |
| Monoisotopic Mass | 410.20932 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(CCC(=O)c2c(O)cc(O)cc2O)ccc1O |
| InChI | InChI=1S/C25H30O5/c1-16(2)5-4-6-17(3)7-10-19-13-18(8-11-21(19)27)9-12-22(28)25-23(29)14-20(26)15-24(25)30/h5,7-8,11,13-15,26-27,29-30H,4,6,9-10,12H2,1-3H3/b17-7+ |
| InChIKey | NJIYMLLTXNGJHV-REZTVBANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boronia bipinnata (IPNI:771577-1) | aerial part (BTO:0001658) | PubMed (18662038) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bipinnatone B (CHEBI:65499) has role antimalarial (CHEBI:38068) |
| bipinnatone B (CHEBI:65499) has role metabolite (CHEBI:25212) |
| bipinnatone B (CHEBI:65499) is a dihydrochalcones (CHEBI:71230) |
| bipinnatone B (CHEBI:65499) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3-{3-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-4-hydroxyphenyl}-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18863622 | Reaxys |
| Citations |
|---|