EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H30O6 |
| Net Charge | 0 |
| Average Mass | 522.597 |
| Monoisotopic Mass | 522.20424 |
| SMILES | Cc1c(O)c2c(c3c1OC1=C(C(=O)C(C)(C)C(=O)C1(C)C)C3c1ccccc1)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C33H30O6/c1-17-26(35)23-20(34)16-21(18-12-8-6-9-13-18)38-28(23)24-22(19-14-10-7-11-15-19)25-29(36)32(2,3)31(37)33(4,5)30(25)39-27(17)24/h6-15,21-22,35H,16H2,1-5H3/t21-,22?/m0/s1 |
| InChIKey | XFYRJHANHCHCTK-HMTLIYDFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Baeckea frutescens (ncbitaxon:199392) | leaf (BTO:0000713) | DOI (10.1016/S0031-9422(98)00534-2) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BF 6 (CHEBI:65490) has role antineoplastic agent (CHEBI:35610) |
| BF 6 (CHEBI:65490) has role metabolite (CHEBI:25212) |
| BF 6 (CHEBI:65490) is a extended flavonoid (CHEBI:71037) |
| BF 6 (CHEBI:65490) is a organic heterotetracyclic compound (CHEBI:38163) |
| BF 6 (CHEBI:65490) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-6,8,8,10,10-pentamethyl-2,12-diphenyl-8,12-dihydro-2H,9H-pyrano[2,3-a]xanthene-4,9,11(3H,10H)-trione |
| Synonym | Source |
|---|---|
| Baeckea frutescens 6 | ChEBI |