EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32O6 |
| Net Charge | 0 |
| Average Mass | 488.580 |
| Monoisotopic Mass | 488.21989 |
| SMILES | COC1=C(C)C2=C(C(=O)C1(C)C)[C@H](C(C)C)c1c(c(C)c(O)c3c1O[C@H](c1ccccc1)CC3=O)O2 |
| InChI | InChI=1S/C30H32O6/c1-14(2)20-22-25(36-26-16(4)29(34-7)30(5,6)28(33)23(20)26)15(3)24(32)21-18(31)13-19(35-27(21)22)17-11-9-8-10-12-17/h8-12,14,19-20,32H,13H2,1-7H3/t19-,20+/m0/s1 |
| InChIKey | NJQFCQXFOHVYQJ-VQTJNVASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Baeckea frutescens (ncbitaxon:199392) | leaf (BTO:0000713) | DOI (10.1016/S0031-9422(98)00534-2) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BF 5 (CHEBI:65489) has role antineoplastic agent (CHEBI:35610) |
| BF 5 (CHEBI:65489) has role metabolite (CHEBI:25212) |
| BF 5 (CHEBI:65489) is a ether (CHEBI:25698) |
| BF 5 (CHEBI:65489) is a extended flavonoid (CHEBI:71037) |
| BF 5 (CHEBI:65489) is a organic heterotetracyclic compound (CHEBI:38163) |
| BF 5 (CHEBI:65489) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2S,12R)-5-hydroxy-9-methoxy-6,8,10,10-tetramethyl-2-phenyl-12-(propan-2-yl)-2,3,10,12-tetrahydro-4H,11H-pyrano[2,3-a]xanthene-4,11-dione |
| Synonym | Source |
|---|---|
| Baeckea frutescens 5 | ChEBI |