EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O4 |
| Net Charge | 0 |
| Average Mass | 458.683 |
| Monoisotopic Mass | 458.33961 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C(C)=O)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C29H46O4/c1-17(30)18-9-14-29(24(32)33)16-15-27(5)19(23(18)29)7-8-21-26(4)12-11-22(31)25(2,3)20(26)10-13-28(21,27)6/h18-23,31H,7-16H2,1-6H3,(H,32,33)/t18-,19+,20-,21+,22-,23+,26-,27+,28+,29-/m0/s1 |
| InChIKey | RVMPLOSJMIQORE-FUAAEJBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Syzygium claviflorum (ncbitaxon:219860) | leaf (BTO:0000713) | PubMed (8176401) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platanic acid (CHEBI:65487) has role anti-HIV agent (CHEBI:64946) |
| platanic acid (CHEBI:65487) has role metabolite (CHEBI:25212) |
| platanic acid (CHEBI:65487) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| platanic acid (CHEBI:65487) is a methyl ketone (CHEBI:51867) |
| platanic acid (CHEBI:65487) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bS)-1-acetyl-9-hydroxy-5a,5b,8,8,11a-pentamethylicosahydro-3aH-cyclopenta[a]chrysene-3a-carboxylic acid |
| Synonym | Source |
|---|---|
| 3β-hydroxy-20-oxo-30-norlupan-28-oic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2681373 | Reaxys |
| CAS:6060-06-6 | ChemIDplus |
| Citations |
|---|