EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O4 |
| Net Charge | 0 |
| Average Mass | 458.683 |
| Monoisotopic Mass | 458.33961 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C(C)=O)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C29H46O4/c1-17(30)18-9-14-29(24(32)33)16-15-27(5)19(23(18)29)7-8-21-26(4)12-11-22(31)25(2,3)20(26)10-13-28(21,27)6/h18-23,31H,7-16H2,1-6H3,(H,32,33)/t18-,19+,20-,21+,22-,23+,26-,27+,28+,29-/m0/s1 |
| InChIKey | RVMPLOSJMIQORE-FUAAEJBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Syzygium claviflorum (ncbitaxon:219860) | leaf (BTO:0000713) | PubMed (8176401) | |
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platanic acid (CHEBI:65487) has role anti-HIV agent (CHEBI:64946) |
| platanic acid (CHEBI:65487) has role metabolite (CHEBI:25212) |
| platanic acid (CHEBI:65487) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| platanic acid (CHEBI:65487) is a methyl ketone (CHEBI:51867) |
| platanic acid (CHEBI:65487) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bS)-1-acetyl-9-hydroxy-5a,5b,8,8,11a-pentamethylicosahydro-3aH-cyclopenta[a]chrysene-3a-carboxylic acid |
| Synonym | Source |
|---|---|
| 3β-hydroxy-20-oxo-30-norlupan-28-oic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2681373 | Reaxys |
| CAS:6060-06-6 | ChemIDplus |
| Citations |
|---|