EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27ClN2O2 |
| Net Charge | 0 |
| Average Mass | 350.890 |
| Monoisotopic Mass | 350.17611 |
| SMILES | COC[C@@]1(CCC(C)=C(C)C)Nc2ccc(C(N)=O)cc2C[C@H]1Cl |
| InChI | InChI=1S/C19H27ClN2O2/c1-12(2)13(3)7-8-19(11-24-4)17(20)10-15-9-14(18(21)23)5-6-16(15)22-19/h5-6,9,17,22H,7-8,10-11H2,1-4H3,(H2,21,23)/t17-,19-/m1/s1 |
| InChIKey | AHGKSZXKDPGMQU-IEBWSBKVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces nitrosporeus (ncbitaxon:28894) | - | PubMed (8609080) | Strain: 30643 |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HSV agent An antiviral agent that destroys or inhibits the replication of the herpes simplex virus (also known as the human herpes virus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzastatin C (CHEBI:65483) has role anti-HSV agent (CHEBI:64952) |
| benzastatin C (CHEBI:65483) has role metabolite (CHEBI:25212) |
| benzastatin C (CHEBI:65483) has role radical scavenger (CHEBI:48578) |
| benzastatin C (CHEBI:65483) is a benzamides (CHEBI:22702) |
| benzastatin C (CHEBI:65483) is a ether (CHEBI:25698) |
| benzastatin C (CHEBI:65483) is a organochlorine compound (CHEBI:36683) |
| benzastatin C (CHEBI:65483) is a quinoline alkaloid (CHEBI:26509) |
| IUPAC Name |
|---|
| (2R,3R)-3-chloro-2-(3,4-dimethylpent-3-en-1-yl)-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoline-6-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7467320 | Reaxys |
| Citations |
|---|