EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21NO6 |
| Net Charge | 0 |
| Average Mass | 395.411 |
| Monoisotopic Mass | 395.13689 |
| SMILES | CC1OC2CC(=O)OC2c2c1c(O)c1c3c(c4n(c23)C(C(C)O)CC4)C=CC1=O |
| InChI | InChI=1S/C22H21NO6/c1-8(24)11-4-5-12-10-3-6-13(25)18-17(10)20(23(11)12)19-16(21(18)27)9(2)28-14-7-15(26)29-22(14)19/h3,6,8-9,11,14,22,24,27H,4-5,7H2,1-2H3 |
| InChIKey | GROPDRMIDADBEP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (10724004) | Strain: A54238 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BE-54238B (CHEBI:65476) has role antimicrobial agent (CHEBI:33281) |
| BE-54238B (CHEBI:65476) has role antineoplastic agent (CHEBI:35610) |
| BE-54238B (CHEBI:65476) has role metabolite (CHEBI:25212) |
| BE-54238B (CHEBI:65476) is a aromatic ketone (CHEBI:76224) |
| BE-54238B (CHEBI:65476) is a cyclic ether (CHEBI:37407) |
| BE-54238B (CHEBI:65476) is a enone (CHEBI:51689) |
| BE-54238B (CHEBI:65476) is a organic heterohexacyclic compound (CHEBI:51914) |
| BE-54238B (CHEBI:65476) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| BE-54238B (CHEBI:65476) is a phenols (CHEBI:33853) |
| BE-54238B (CHEBI:65476) is a secondary alcohol (CHEBI:35681) |
| BE-54238B (CHEBI:65476) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 7-hydroxy-1-(1-hydroxyethyl)-8-methyl-2,3,8,9a,10,12a-hexahydro-6H-benzo[cd]furo[2',3':5,6]pyrano[3,4-g]pyrrolo[1,2-a]indole-6,11(1H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8517555 | Reaxys |
| Citations |
|---|