EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23NO6 |
| Net Charge | 0 |
| Average Mass | 397.427 |
| Monoisotopic Mass | 397.15254 |
| SMILES | CC1OC(CC(=O)O)Cc2c1c(O)c1c3c(c4n(c23)C(C(C)O)CC4)C=CC1=O |
| InChI | InChI=1S/C22H23NO6/c1-9(24)14-4-5-15-12-3-6-16(25)20-19(12)21(23(14)15)13-7-11(8-17(26)27)29-10(2)18(13)22(20)28/h3,6,9-11,14,24,28H,4-5,7-8H2,1-2H3,(H,26,27) |
| InChIKey | AWMWNWIBOOYESP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (10724004) | Strain: A54238 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BE-54238A (CHEBI:65475) has role antimicrobial agent (CHEBI:33281) |
| BE-54238A (CHEBI:65475) has role antineoplastic agent (CHEBI:35610) |
| BE-54238A (CHEBI:65475) has role metabolite (CHEBI:25212) |
| BE-54238A (CHEBI:65475) is a aromatic ketone (CHEBI:76224) |
| BE-54238A (CHEBI:65475) is a cyclic ether (CHEBI:37407) |
| BE-54238A (CHEBI:65475) is a enone (CHEBI:51689) |
| BE-54238A (CHEBI:65475) is a organic heteropentacyclic compound (CHEBI:38164) |
| BE-54238A (CHEBI:65475) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| BE-54238A (CHEBI:65475) is a oxo monocarboxylic acid (CHEBI:35871) |
| BE-54238A (CHEBI:65475) is a phenols (CHEBI:33853) |
| BE-54238A (CHEBI:65475) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| [7-hydroxy-1-(1-hydroxyethyl)-8-methyl-6-oxo-1,2,3,8,10,11-hexahydro-6H-benzo[cd]pyrano[3,4-g]pyrrolo[1,2-a]indol-10-yl]acetic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8519118 | Reaxys |
| Citations |
|---|