EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24O7 |
| Net Charge | 0 |
| Average Mass | 460.482 |
| Monoisotopic Mass | 460.15220 |
| SMILES | Cc1cc(O)cc2c1C1OC(C)(Cc3cc4c(c(O)c31)C(=O)c1c(O)cc(O)cc1C4(C)C)O2 |
| InChI | InChI=1S/C27H24O7/c1-11-5-13(28)9-18-19(11)25-20-12(10-27(4,33-18)34-25)6-15-22(23(20)31)24(32)21-16(26(15,2)3)7-14(29)8-17(21)30/h5-9,25,28-31H,10H2,1-4H3 |
| InChIKey | MDUGEFRGUDVHQH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces violaceusniger (ncbitaxon:68280) | - | PubMed (8557611) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BE-24566B (CHEBI:65474) has role antibacterial agent (CHEBI:33282) |
| BE-24566B (CHEBI:65474) has role antimicrobial agent (CHEBI:33281) |
| BE-24566B (CHEBI:65474) has role metabolite (CHEBI:25212) |
| BE-24566B (CHEBI:65474) is a bridged compound (CHEBI:35990) |
| BE-24566B (CHEBI:65474) is a cyclic ketone (CHEBI:3992) |
| BE-24566B (CHEBI:65474) is a organic heterohexacyclic compound (CHEBI:51914) |
| BE-24566B (CHEBI:65474) is a oxacycle (CHEBI:38104) |
| BE-24566B (CHEBI:65474) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3,11,13,15-tetrahydroxy-1,6,9,9-tetramethyl-6,7,9,16-tetrahydro-14H-6,16-epoxyanthra[2,3-e]benzo[b]oxocin-14-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15840383 | Reaxys |
| Citations |
|---|