EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O4 |
| Net Charge | 0 |
| Average Mass | 338.403 |
| Monoisotopic Mass | 338.15181 |
| SMILES | COc1c(C)c(O)cc2c1Oc1ccc(CC=C(C)C)c(O)c1C=C2 |
| InChI | InChI=1S/C21H22O4/c1-12(2)5-6-14-8-10-18-16(19(14)23)9-7-15-11-17(22)13(3)20(24-4)21(15)25-18/h5,7-11,22-23H,6H2,1-4H3 |
| InChIKey | LSRDCIRGVJBGRF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bauhinia saccocalyx (IPNI:481650-1) | root (BTO:0001188) | DOI (10.1002/hlca.200490006) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| Application: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bauhinoxepin B (CHEBI:65469) has role antimycobacterial drug (CHEBI:64912) |
| bauhinoxepin B (CHEBI:65469) has role metabolite (CHEBI:25212) |
| bauhinoxepin B (CHEBI:65469) is a aromatic ether (CHEBI:35618) |
| bauhinoxepin B (CHEBI:65469) is a dibenzooxepine (CHEBI:38926) |
| bauhinoxepin B (CHEBI:65469) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 6-methoxy-7-methyl-2-(3-methylbut-2-enyl)dibenzo[b,f]oxepine-1,8-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9798611 | Reaxys |